C19H21FN2O7 — CID 87243683
[(1S)-1-[(2R)-4-[2-fluoro-3-(morpholine-4-carbonyl)phenyl]-3-oxomorpholin-2-yl]-2-oxoethyl] acetate (PubChem CID 87243683) has the molecular formula C19H21FN2O7 and a molecular weight of 408.38 g/mol. Its IUPAC name is [(1S)-1-[(2R)-4-[2-fluoro-3-(morpholine-4-carbonyl)phenyl]-3-oxomorpholin-2-yl]-2-oxoethyl] acetate.
| Compound Name | [(1S)-1-[(2R)-4-[2-fluoro-3-(morpholine-4-carbonyl)phenyl]-3-oxomorpholin-2-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 87243683 |
| Molecular Formula | C19H21FN2O7 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(1S)-1-[(2R)-4-[2-fluoro-3-(morpholine-4-carbonyl)phenyl]-3-oxomorpholin-2-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)O[C@H](C=O)[C@H]1OCCN(c2cccc(C(=O)N3CCOCC3)c2F)C1=O |
| InChI | InChI=1S/C19H21FN2O7/c1-12(24)29-15(11-23)17-19(26)22(7-10-28-17)14-4-2-3-13(16(14)20)18(25)21-5-8-27-9-6-21/h2-4,11,15,17H,5-10H2,1H3/t15-,17-/m1/s1 |
| InChIKey | RQGOJYFPTBFWMN-NVXWUHKLSA-N |
| XLogP | 0.16 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|