About 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide
1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide (PubChem CID 87243833) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide.
Molecular Properties
| Compound Name | 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide |
| PubChem CID | 87243833 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide |
| SMILES | NC(=O)C1=Cc2ccccc2[NH+]([O-])C1 |
| InChI | InChI=1S/C10H10N2O2/c11-10(13)8-5-7-3-1-2-4-9(7)12(14)6-8/h1-5,12H,6H2,(H2,11,13) |
| InChIKey | YLZVPKKVPFBWPE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide?
The IUPAC name of 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide (CID 87243833) is 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide.
What is the SMILES notation for 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide?
The canonical SMILES for 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide is NC(=O)C1=Cc2ccccc2[NH+]([O-])C1.
What is the InChIKey of 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide?
The InChIKey is YLZVPKKVPFBWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c11-10(13)8-5-7-3-1-2-4-9(7)12(14)6-8/h1-5,12H,6H2,(H2,11,13).
What are the key properties of 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide?
1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide has a molecular weight of 190.20 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-1,2-dihydroquinolin-1-ium-3-carboxamide is sourced from PubChem (CID 87243833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).