About nitrous acid;tetrakis(prop-2-enyl)azanium
nitrous acid;tetrakis(prop-2-enyl)azanium (PubChem CID 87243900) has the molecular formula C12H21N2O2+
and a molecular weight of 225.31 g/mol. Its IUPAC name is nitrous acid;tetrakis(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | nitrous acid;tetrakis(prop-2-enyl)azanium |
| PubChem CID | 87243900 |
| Molecular Formula | C12H21N2O2+ |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | nitrous acid;tetrakis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)(CC=C)CC=C.O=NO |
| InChI | InChI=1S/C12H20N.HNO2/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1-3/h5-8H,1-4,9-12H2;(H,2,3)/q+1; |
| InChIKey | FLXGHPDJBYGVJT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze nitrous acid;tetrakis(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrous acid;tetrakis(prop-2-enyl)azanium?
The IUPAC name of nitrous acid;tetrakis(prop-2-enyl)azanium (CID 87243900) is nitrous acid;tetrakis(prop-2-enyl)azanium.
What is the SMILES notation for nitrous acid;tetrakis(prop-2-enyl)azanium?
The canonical SMILES for nitrous acid;tetrakis(prop-2-enyl)azanium is C=CC[N+](CC=C)(CC=C)CC=C.O=NO.
What is the InChIKey of nitrous acid;tetrakis(prop-2-enyl)azanium?
The InChIKey is FLXGHPDJBYGVJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N.HNO2/c1-5-9-13(10-6-2,11-7-3)12-8-4;2-1-3/h5-8H,1-4,9-12H2;(H,2,3)/q+1;.
What are the key properties of nitrous acid;tetrakis(prop-2-enyl)azanium?
nitrous acid;tetrakis(prop-2-enyl)azanium has a molecular weight of 225.31 g/mol, XLogP of 2.69, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nitrous acid;tetrakis(prop-2-enyl)azanium is sourced from PubChem (CID 87243900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).