About (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate
(cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate (PubChem CID 87244043) has the molecular formula C18H22Cl2N4O2
and a molecular weight of 397.31 g/mol. Its IUPAC name is (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate |
| PubChem CID | 87244043 |
| Molecular Formula | C18H22Cl2N4O2 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate |
| SMILES | O=C(ONC1CCCC1)C1CCN(c2nc3cc(Cl)c(Cl)cc3[nH]2)CC1 |
| InChI | InChI=1S/C18H22Cl2N4O2/c19-13-9-15-16(10-14(13)20)22-18(21-15)24-7-5-11(6-8-24)17(25)26-23-12-3-1-2-4-12/h9-12,23H,1-8H2,(H,21,22) |
| InChIKey | WKJNQPLTRZRTRM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate?
The IUPAC name of (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate (CID 87244043) is (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate.
What is the SMILES notation for (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate?
The canonical SMILES for (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate is O=C(ONC1CCCC1)C1CCN(c2nc3cc(Cl)c(Cl)cc3[nH]2)CC1.
What is the InChIKey of (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate?
The InChIKey is WKJNQPLTRZRTRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22Cl2N4O2/c19-13-9-15-16(10-14(13)20)22-18(21-15)24-7-5-11(6-8-24)17(25)26-23-12-3-1-2-4-12/h9-12,23H,1-8H2,(H,21,22).
What are the key properties of (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate?
(cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate has a molecular weight of 397.31 g/mol, XLogP of 4.08, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (cyclopentylamino) 1-(5,6-dichloro-1H-benzimidazol-2-yl)piperidine-4-carboxylate is sourced from PubChem (CID 87244043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).