C7H12N2S — CID 87244198
2,3,3a,4-tetrahydrothieno[3,2-b]pyridine;azane (PubChem CID 87244198) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydrothieno[3,2-b]pyridine;azane.
| Compound Name | 2,3,3a,4-tetrahydrothieno[3,2-b]pyridine;azane |
|---|---|
| PubChem CID | 87244198 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 2,3,3a,4-tetrahydrothieno[3,2-b]pyridine;azane |
| SMILES | C1=CNC2CCSC2=C1.N |
| InChI | InChI=1S/C7H9NS.H3N/c1-2-7-6(8-4-1)3-5-9-7;/h1-2,4,6,8H,3,5H2;1H3 |
| InChIKey | VTZNDVFIYGXDMZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |