About magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride
magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride (PubChem CID 87244324) has the molecular formula C8H3ClF6Mg
and a molecular weight of 272.86 g/mol. Its IUPAC name is magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride.
Molecular Properties
| Compound Name | magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride |
| PubChem CID | 87244324 |
| Molecular Formula | C8H3ClF6Mg |
| Molecular Weight | 272.86 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride |
| SMILES | FC(F)(F)c1[c-]cccc1C(F)(F)F.[Cl-].[Mg+2] |
| InChI | InChI=1S/C8H3F6.ClH.Mg/c9-7(10,11)5-3-1-2-4-6(5)8(12,13)14;;/h1-3H;1H;/q-1;;+2/p-1 |
| InChIKey | XXZFOQYYKBHATO-UHFFFAOYSA-M |
| XLogP | 0.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.86 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride?
The IUPAC name of magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride (CID 87244324) is magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride.
What is the SMILES notation for magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride?
The canonical SMILES for magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride is FC(F)(F)c1[c-]cccc1C(F)(F)F.[Cl-].[Mg+2].
What is the InChIKey of magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride?
The InChIKey is XXZFOQYYKBHATO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H3F6.ClH.Mg/c9-7(10,11)5-3-1-2-4-6(5)8(12,13)14;;/h1-3H;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride?
magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride has a molecular weight of 272.86 g/mol, XLogP of 0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1,2-bis(trifluoromethyl)benzene-6-ide;chloride is sourced from PubChem (CID 87244324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).