C16H11Cl2N3O6 — CID 87244512
5-[2-(2,5-dichloro-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)-1,3-oxazol-4-yl]-3-nitrobenzene-1,2-diol (PubChem CID 87244512) has the molecular formula C16H11Cl2N3O6 and a molecular weight of 412.19 g/mol. Its IUPAC name is 5-[2-(2,5-dichloro-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)-1,3-oxazol-4-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[2-(2,5-dichloro-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)-1,3-oxazol-4-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 87244512 |
| Molecular Formula | C16H11Cl2N3O6 |
| Molecular Weight | 412.19 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 5-[2-(2,5-dichloro-4,6-dimethyl-1-oxidopyridin-1-ium-3-yl)-1,3-oxazol-4-yl]-3-nitrobenzene-1,2-diol |
| SMILES | Cc1c(Cl)c(C)[n+]([O-])c(Cl)c1-c1nc(-c2cc(O)c(O)c([N+](=O)[O-])c2)co1 |
| InChI | InChI=1S/C16H11Cl2N3O6/c1-6-12(15(18)20(24)7(2)13(6)17)16-19-9(5-27-16)8-3-10(21(25)26)14(23)11(22)4-8/h3-5,22-23H,1-2H3 |
| InChIKey | JBPNCLCNKBNYFV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 136.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|