C36H45ClN2O — CID 87244677
6-[10-[(1E,3E,5E)-5-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)penta-1,3-dienyl]-9-methyl-1-azoniatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol chloride (PubChem CID 87244677) has the molecular formula C36H45ClN2O and a molecular weight of 557.22 g/mol. Its IUPAC name is 6-[10-[(1E,3E,5E)-5-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)penta-1,3-dienyl]-9-methyl-1-azoniatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol chloride.
| Compound Name | 6-[10-[(1E,3E,5E)-5-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)penta-1,3-dienyl]-9-methyl-1-azoniatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol chloride |
|---|---|
| PubChem CID | 87244677 |
| Molecular Formula | C36H45ClN2O |
| Molecular Weight | 557.22 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | 6-[10-[(1E,3E,5E)-5-(3,3-dimethyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-ylidene)penta-1,3-dienyl]-9-methyl-1-azoniatricyclo[6.3.1.04,12]dodeca-4(12),5,7,10-tetraen-9-yl]hexan-1-ol chloride |
| SMILES | CC1(CCCCCCO)C(/C=C/C=C/C=C2/N3CCCc4cccc(c43)C2(C)C)=C[NH+]2CCc3cccc1c32.[Cl-] |
| InChI | InChI=1S/C36H44N2O.ClH/c1-35(2)30-18-11-14-27-16-13-23-38(34(27)30)32(35)20-8-6-7-17-29-26-37-24-21-28-15-12-19-31(33(28)37)36(29,3)22-9-4-5-10-25-39;/h6-8,11-12,14-15,17-20,26,39H,4-5,9-10,13,16,21-25H2,1-3H3;1H/b8-6+,17-7+,32-20+; |
| InChIKey | YBOZFJPPCDYJCQ-YUDCFIOYSA-N |
| XLogP | 3.60 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|