C25H18Cl6N4 — CID 87245037
4-[4,6-bis(2,2,2-trichloroethyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline (PubChem CID 87245037) has the molecular formula C25H18Cl6N4 and a molecular weight of 587.17 g/mol. Its IUPAC name is 4-[4,6-bis(2,2,2-trichloroethyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline.
| Compound Name | 4-[4,6-bis(2,2,2-trichloroethyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 87245037 |
| Molecular Formula | C25H18Cl6N4 |
| Molecular Weight | 587.17 g/mol |
| Exact Mass | 583.97 |
| IUPAC Name | 4-[4,6-bis(2,2,2-trichloroethyl)-1,3,5-triazin-2-yl]-N,N-diphenylaniline |
| SMILES | ClC(Cl)(Cl)Cc1nc(CC(Cl)(Cl)Cl)nc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C25H18Cl6N4/c26-24(27,28)15-21-32-22(16-25(29,30)31)34-23(33-21)17-11-13-20(14-12-17)35(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14H,15-16H2 |
| InChIKey | MQFJLDINMNKXNW-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.17 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|