About 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid
1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid (PubChem CID 87245078) has the molecular formula C8H16F4N2O3S+2
and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid |
| PubChem CID | 87245078 |
| Molecular Formula | C8H16F4N2O3S+2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid |
| SMILES | C[N+]12CC[N+](F)(CC1)CC2.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C7H15FN2.CHF3O3S/c1-9-2-5-10(8,6-3-9)7-4-9;2-1(3,4)8(5,6)7/h2-7H2,1H3;(H,5,6,7)/q+2; |
| InChIKey | ZSWJOTXHCPSUMH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid?
The IUPAC name of 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid (CID 87245078) is 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid?
The canonical SMILES for 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid is C[N+]12CC[N+](F)(CC1)CC2.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid?
The InChIKey is ZSWJOTXHCPSUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15FN2.CHF3O3S/c1-9-2-5-10(8,6-3-9)7-4-9;2-1(3,4)8(5,6)7/h2-7H2,1H3;(H,5,6,7)/q+2;.
What are the key properties of 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid?
1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid has a molecular weight of 296.29 g/mol, XLogP of 0.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methyl-1,4-diazoniabicyclo[2.2.2]octane;trifluoromethanesulfonic acid is sourced from PubChem (CID 87245078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).