C42H21BF16Si — CID 87245412
tetrakis(2,3,4,5-tetrafluorophenyl)boranuide;triphenylsilanylium (PubChem CID 87245412) has the molecular formula C42H21BF16Si and a molecular weight of 868.50 g/mol. Its IUPAC name is tetrakis(2,3,4,5-tetrafluorophenyl)boranuide;triphenylsilanylium.
| Compound Name | tetrakis(2,3,4,5-tetrafluorophenyl)boranuide;triphenylsilanylium |
|---|---|
| PubChem CID | 87245412 |
| Molecular Formula | C42H21BF16Si |
| Molecular Weight | 868.50 g/mol |
| Exact Mass | 868.13 |
| IUPAC Name | tetrakis(2,3,4,5-tetrafluorophenyl)boranuide;triphenylsilanylium |
| SMILES | Fc1cc([B-](c2cc(F)c(F)c(F)c2F)(c2cc(F)c(F)c(F)c2F)c2cc(F)c(F)c(F)c2F)c(F)c(F)c1F.c1ccc([SiH2+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H4BF16.C18H17Si/c26-9-1-5(13(30)21(38)17(9)34)25(6-2-10(27)18(35)22(39)14(6)31,7-3-11(28)19(36)23(40)15(7)32)8-4-12(29)20(37)24(41)16(8)33;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-4H;1-15H,19H2/q-1;+1 |
| InChIKey | QKBCMOHXTPGIBA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.50 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|