C25H27BrSi — CID 87245819
(4-bromo-2-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[b]naphthalen-1-yl)-(1H-inden-2-yl)-dimethylsilane (PubChem CID 87245819) has the molecular formula C25H27BrSi and a molecular weight of 435.48 g/mol. Its IUPAC name is (4-bromo-2-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[b]naphthalen-1-yl)-(1H-inden-2-yl)-dimethylsilane.
| Compound Name | (4-bromo-2-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[b]naphthalen-1-yl)-(1H-inden-2-yl)-dimethylsilane |
|---|---|
| PubChem CID | 87245819 |
| Molecular Formula | C25H27BrSi |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (4-bromo-2-methyl-5,6,7,8-tetrahydro-4H-cyclopenta[b]naphthalen-1-yl)-(1H-inden-2-yl)-dimethylsilane |
| SMILES | CC1=C([Si](C)(C)C2=Cc3ccccc3C2)C2=CC3=C(CCCC3)C(Br)C2=C1 |
| InChI | InChI=1S/C25H27BrSi/c1-16-12-22-23(15-19-10-6-7-11-21(19)24(22)26)25(16)27(2,3)20-13-17-8-4-5-9-18(17)14-20/h4-5,8-9,12-13,15,24H,6-7,10-11,14H2,1-3H3 |
| InChIKey | CRCNAHNLTXFIGD-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|