About 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate
1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate (PubChem CID 87246136) has the molecular formula C14H9F3N2O5S
and a molecular weight of 374.30 g/mol. Its IUPAC name is 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate |
| PubChem CID | 87246136 |
| Molecular Formula | C14H9F3N2O5S |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate |
| SMILES | C[n+]1cccc2c1-c1ncccc1C(=O)C2=O.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H9N2O2.CHF3O3S/c1-15-7-3-5-9-11(15)10-8(4-2-6-14-10)12(16)13(9)17;2-1(3,4)8(5,6)7/h2-7H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | JOUVLAZOIVGSAW-UHFFFAOYSA-M |
| XLogP | 1.00 |
| TPSA | 108.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate?
The IUPAC name of 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate (CID 87246136) is 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate.
What is the SMILES notation for 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate?
The canonical SMILES for 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate is C[n+]1cccc2c1-c1ncccc1C(=O)C2=O.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate?
The InChIKey is JOUVLAZOIVGSAW-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H9N2O2.CHF3O3S/c1-15-7-3-5-9-11(15)10-8(4-2-6-14-10)12(16)13(9)17;2-1(3,4)8(5,6)7/h2-7H,1H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate?
1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate has a molecular weight of 374.30 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1,10-phenanthrolin-1-ium-5,6-dione;trifluoromethanesulfonate is sourced from PubChem (CID 87246136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).