About N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide
N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide (PubChem CID 87246771) has the molecular formula C21H20N2O2S
and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide |
| PubChem CID | 87246771 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/C(=C(\N)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17/h2-15,23H,22H2,1H3/b21-20- |
| InChIKey | BEMRQAALSGVBQA-MRCUWXFGSA-N |
| XLogP | 3.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide (CID 87246771) is N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N/C(=C(\N)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide?
The InChIKey is BEMRQAALSGVBQA-MRCUWXFGSA-N. The full InChI is InChI=1S/C21H20N2O2S/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17/h2-15,23H,22H2,1H3/b21-20-.
What are the key properties of N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide?
N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide has a molecular weight of 364.47 g/mol, XLogP of 3.76, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2-amino-1,2-diphenylethenyl]-4-methylbenzenesulfonamide is sourced from PubChem (CID 87246771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).