About [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate
[4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate (PubChem CID 87246899) has the molecular formula C31H26F6O6S3
and a molecular weight of 704.73 g/mol. Its IUPAC name is [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate.
Molecular Properties
| Compound Name | [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate |
| PubChem CID | 87246899 |
| Molecular Formula | C31H26F6O6S3 |
| Molecular Weight | 704.73 g/mol |
| Exact Mass | 704.08 |
| IUPAC Name | [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate |
| SMILES | CC(CC(S(c1ccccc1)(c1ccccc1)c1ccccc1)(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H26F6O6S3/c1-23(43-28(38)24-14-6-2-7-15-24)22-29(45(39,40)30(32,33)34,46(41,42)31(35,36)37)44(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,23H,22H2,1H3 |
| InChIKey | BCDMJBNFLHYCPV-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 704.73 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate?
The IUPAC name of [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate (CID 87246899) is [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate.
What is the SMILES notation for [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate?
The canonical SMILES for [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate is CC(CC(S(c1ccccc1)(c1ccccc1)c1ccccc1)(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)OC(=O)c1ccccc1.
What is the InChIKey of [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate?
The InChIKey is BCDMJBNFLHYCPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26F6O6S3/c1-23(43-28(38)24-14-6-2-7-15-24)22-29(45(39,40)30(32,33)34,46(41,42)31(35,36)37)44(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,23H,22H2,1H3.
What are the key properties of [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate?
[4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate has a molecular weight of 704.73 g/mol, XLogP of 8.13, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-bis(trifluoromethylsulfonyl)-4-(triphenyl-λ4-sulfanyl)butan-2-yl] benzoate is sourced from PubChem (CID 87246899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).