C25H45ClOP2Ru — CID 87247139
chlororuthenium(1+);ditert-butyl-[[3-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane;methanone (PubChem CID 87247139) has the molecular formula C25H45ClOP2Ru and a molecular weight of 560.11 g/mol. Its IUPAC name is chlororuthenium(1+);ditert-butyl-[[3-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane;methanone.
| Compound Name | chlororuthenium(1+);ditert-butyl-[[3-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane;methanone |
|---|---|
| PubChem CID | 87247139 |
| Molecular Formula | C25H45ClOP2Ru |
| Molecular Weight | 560.11 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | chlororuthenium(1+);ditert-butyl-[[3-(ditert-butylphosphanylmethyl)phenyl]methyl]phosphane;methanone |
| SMILES | CC(C)(C)P(Cc1cccc(CP(C(C)(C)C)C(C)(C)C)c1)C(C)(C)C.Cl[Ru+].[CH-]=O |
| InChI | InChI=1S/C24H44P2.CHO.ClH.Ru/c1-21(2,3)25(22(4,5)6)17-19-14-13-15-20(16-19)18-26(23(7,8)9)24(10,11)12;1-2;;/h13-16H,17-18H2,1-12H3;1H;1H;/q;-1;;+2/p-1 |
| InChIKey | XQYCUTOABYBCEP-UHFFFAOYSA-M |
| XLogP | 9.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.11 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|