C25H18F4N4O5 — CID 87247245
[6-[1-hydroxy-3-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]isoindol-1-yl]-1H-benzimidazol-2-yl]-methylcarbamic acid (PubChem CID 87247245) has the molecular formula C25H18F4N4O5 and a molecular weight of 530.43 g/mol. Its IUPAC name is [6-[1-hydroxy-3-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]isoindol-1-yl]-1H-benzimidazol-2-yl]-methylcarbamic acid.
| Compound Name | [6-[1-hydroxy-3-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]isoindol-1-yl]-1H-benzimidazol-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 87247245 |
| Molecular Formula | C25H18F4N4O5 |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | [6-[1-hydroxy-3-oxo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]isoindol-1-yl]-1H-benzimidazol-2-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1nc2ccc(C3(O)c4ccccc4C(=O)N3c3cccc(OC(F)(F)C(F)F)c3)cc2[nH]1 |
| InChI | InChI=1S/C25H18F4N4O5/c1-32(23(35)36)22-30-18-10-9-13(11-19(18)31-22)24(37)17-8-3-2-7-16(17)20(34)33(24)14-5-4-6-15(12-14)38-25(28,29)21(26)27/h2-12,21,37H,1H3,(H,30,31)(H,35,36) |
| InChIKey | JDOPVRJEKZHGQF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|