About 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine
4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine (PubChem CID 87247267) has the molecular formula C16H14Cl3N5O
and a molecular weight of 398.68 g/mol. Its IUPAC name is 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine.
Molecular Properties
| Compound Name | 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine |
| PubChem CID | 87247267 |
| Molecular Formula | C16H14Cl3N5O |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine |
| SMILES | Clc1ccnc(Cl)n1.Oc1ccc(CCNc2nccc(Cl)n2)cc1 |
| InChI | InChI=1S/C12H12ClN3O.C4H2Cl2N2/c13-11-6-8-15-12(16-11)14-7-5-9-1-3-10(17)4-2-9;5-3-1-2-7-4(6)8-3/h1-4,6,8,17H,5,7H2,(H,14,15,16);1-2H |
| InChIKey | XEWNPVYYTMOFRW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine?
The IUPAC name of 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine (CID 87247267) is 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine.
What is the SMILES notation for 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine?
The canonical SMILES for 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine is Clc1ccnc(Cl)n1.Oc1ccc(CCNc2nccc(Cl)n2)cc1.
What is the InChIKey of 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine?
The InChIKey is XEWNPVYYTMOFRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3O.C4H2Cl2N2/c13-11-6-8-15-12(16-11)14-7-5-9-1-3-10(17)4-2-9;5-3-1-2-7-4(6)8-3/h1-4,6,8,17H,5,7H2,(H,14,15,16);1-2H.
What are the key properties of 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine?
4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine has a molecular weight of 398.68 g/mol, XLogP of 4.27, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(4-chloropyrimidin-2-yl)amino]ethyl]phenol;2,4-dichloropyrimidine is sourced from PubChem (CID 87247267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).