About fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate
fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate (PubChem CID 87247395) has the molecular formula C4H6F5O4P
and a molecular weight of 244.05 g/mol. Its IUPAC name is fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate.
Molecular Properties
| Compound Name | fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate |
| PubChem CID | 87247395 |
| Molecular Formula | C4H6F5O4P |
| Molecular Weight | 244.05 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate |
| SMILES | COP(=O)(OF)OC(F)C(F)C(F)F |
| InChI | InChI=1S/C4H6F5O4P/c1-11-14(10,13-9)12-4(8)2(5)3(6)7/h2-4H,1H3 |
| InChIKey | SXQOXPRXCKXDQO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.05 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate?
The IUPAC name of fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate (CID 87247395) is fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate.
What is the SMILES notation for fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate?
The canonical SMILES for fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate is COP(=O)(OF)OC(F)C(F)C(F)F.
What is the InChIKey of fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate?
The InChIKey is SXQOXPRXCKXDQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F5O4P/c1-11-14(10,13-9)12-4(8)2(5)3(6)7/h2-4H,1H3.
What are the key properties of fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate?
fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate has a molecular weight of 244.05 g/mol, XLogP of 2.56, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro methyl 1,2,3,3-tetrafluoropropyl phosphate is sourced from PubChem (CID 87247395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).