C18H17F3N2O — CID 8724752
2-[(2S)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 8724752) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-[(2S)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(2S)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 8724752 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[(2S)-2-methyl-3,4-dihydro-2H-quinolin-1-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C[C@H]1CCc2ccccc2N1CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H17F3N2O/c1-11-6-7-12-4-2-3-5-15(12)23(11)10-16(24)22-14-9-8-13(19)17(20)18(14)21/h2-5,8-9,11H,6-7,10H2,1H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | WECCUHTUURKCEG-NSHDSACASA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|