C26H12Cl8N4O4 — CID 87247893
1,2,5,6,7,8,11,12-octachloro-9-N,10-N-dimethylperylene-3,4,9,10-tetracarboxamide (PubChem CID 87247893) has the molecular formula C26H12Cl8N4O4 and a molecular weight of 728.03 g/mol. Its IUPAC name is 1,2,5,6,7,8,11,12-octachloro-9-N,10-N-dimethylperylene-3,4,9,10-tetracarboxamide.
| Compound Name | 1,2,5,6,7,8,11,12-octachloro-9-N,10-N-dimethylperylene-3,4,9,10-tetracarboxamide |
|---|---|
| PubChem CID | 87247893 |
| Molecular Formula | C26H12Cl8N4O4 |
| Molecular Weight | 728.03 g/mol |
| Exact Mass | 723.84 |
| IUPAC Name | 1,2,5,6,7,8,11,12-octachloro-9-N,10-N-dimethylperylene-3,4,9,10-tetracarboxamide |
| SMILES | CNC(=O)c1c(Cl)c(Cl)c2c3c(Cl)c(Cl)c(C(N)=O)c4c(C(N)=O)c(Cl)c(Cl)c(c5c(Cl)c(Cl)c(C(=O)NC)c1c25)c43 |
| InChI | InChI=1S/C26H12Cl8N4O4/c1-37-25(41)13-6-4-9(17(29)21(13)33)7-3-5(11(23(35)39)19(31)15(7)27)12(24(36)40)20(32)16(28)8(3)10(4)18(30)22(34)14(6)26(42)38-2/h1-2H3,(H2,35,39)(H2,36,40)(H,37,41)(H,38,42) |
| InChIKey | NCHRHENOXGPFNT-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.03 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|