About CID 87248127
CID 87248127 (PubChem CID 87248127) has the molecular formula C18H33OSi
and a molecular weight of 293.55 g/mol.
Molecular Properties
| Compound Name | CID 87248127 |
| PubChem CID | 87248127 |
| Molecular Formula | C18H33OSi |
| Molecular Weight | 293.55 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | — |
| SMILES | C=C[C@H](C[C@H](CC#CO[Si](C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H33OSi/c1-10-15(17(2,3)4)14-16(18(5,6)7)12-11-13-19-20(8)9/h10,15-16H,1,12,14H2,2-9H3/t15-,16+/m1/s1 |
| InChIKey | RTCZJWMPJCYVSI-CVEARBPZSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 87248127 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87248127?
The IUPAC name of CID 87248127 (CID 87248127) is not available.
What is the SMILES notation for CID 87248127?
The canonical SMILES for CID 87248127 is C=C[C@H](C[C@H](CC#CO[Si](C)C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of CID 87248127?
The InChIKey is RTCZJWMPJCYVSI-CVEARBPZSA-N. The full InChI is InChI=1S/C18H33OSi/c1-10-15(17(2,3)4)14-16(18(5,6)7)12-11-13-19-20(8)9/h10,15-16H,1,12,14H2,2-9H3/t15-,16+/m1/s1.
What are the key properties of CID 87248127?
CID 87248127 has a molecular weight of 293.55 g/mol, XLogP of 5.51, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87248127 is sourced from PubChem (CID 87248127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).