About 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene
2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene (PubChem CID 87248422) has the molecular formula C11H22O5
and a molecular weight of 234.29 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene.
Molecular Properties
| Compound Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene |
| PubChem CID | 87248422 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene |
| SMILES | C/C=C\O/C=C\C.OCC(CO)(CO)CO |
| InChI | InChI=1S/C6H10O.C5H12O4/c1-3-5-7-6-4-2;6-1-5(2-7,3-8)4-9/h3-6H,1-2H3;6-9H,1-4H2/b5-3-,6-4-; |
| InChIKey | ZXUDIYIWCMTYLX-VIOUERSGSA-N |
| XLogP | 0.01 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene?
The IUPAC name of 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene (CID 87248422) is 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene.
What is the SMILES notation for 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene?
The canonical SMILES for 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene is C/C=C\O/C=C\C.OCC(CO)(CO)CO.
What is the InChIKey of 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene?
The InChIKey is ZXUDIYIWCMTYLX-VIOUERSGSA-N. The full InChI is InChI=1S/C6H10O.C5H12O4/c1-3-5-7-6-4-2;6-1-5(2-7,3-8)4-9/h3-6H,1-2H3;6-9H,1-4H2/b5-3-,6-4-;.
What are the key properties of 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene?
2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene has a molecular weight of 234.29 g/mol, XLogP of 0.01, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(hydroxymethyl)propane-1,3-diol;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene is sourced from PubChem (CID 87248422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).