About O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate
O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate (PubChem CID 87248817) has the molecular formula C18H29NOSSi2
and a molecular weight of 363.68 g/mol. Its IUPAC name is O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate.
Molecular Properties
| Compound Name | O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate |
| PubChem CID | 87248817 |
| Molecular Formula | C18H29NOSSi2 |
| Molecular Weight | 363.68 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate |
| SMILES | C#CCC(CC(=S)Oc1ccccc1)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H29NOSSi2/c1-8-12-16(19(22(2,3)4)23(5,6)7)15-18(21)20-17-13-10-9-11-14-17/h1,9-11,13-14,16H,12,15H2,2-7H3 |
| InChIKey | ASXYKTYBXGXDGD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate?
The IUPAC name of O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate (CID 87248817) is O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate.
What is the SMILES notation for O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate?
The canonical SMILES for O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate is C#CCC(CC(=S)Oc1ccccc1)N([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate?
The InChIKey is ASXYKTYBXGXDGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NOSSi2/c1-8-12-16(19(22(2,3)4)23(5,6)7)15-18(21)20-17-13-10-9-11-14-17/h1,9-11,13-14,16H,12,15H2,2-7H3.
What are the key properties of O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate?
O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate has a molecular weight of 363.68 g/mol, XLogP of 5.15, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-phenyl 3-[bis(trimethylsilyl)amino]hex-5-ynethioate is sourced from PubChem (CID 87248817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).