About bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate
bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate (PubChem CID 87249059) has the molecular formula C16H20O6
and a molecular weight of 308.33 g/mol. Its IUPAC name is bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate |
| PubChem CID | 87249059 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OC(=O)C1CCCCC1C(=O)OC(=O)C(=C)C |
| InChI | InChI=1S/C16H20O6/c1-9(2)13(17)21-15(19)11-7-5-6-8-12(11)16(20)22-14(18)10(3)4/h11-12H,1,3,5-8H2,2,4H3 |
| InChIKey | DCZPYGVQHPGLEI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate?
The IUPAC name of bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate (CID 87249059) is bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate?
The canonical SMILES for bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate is C=C(C)C(=O)OC(=O)C1CCCCC1C(=O)OC(=O)C(=C)C.
What is the InChIKey of bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate?
The InChIKey is DCZPYGVQHPGLEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O6/c1-9(2)13(17)21-15(19)11-7-5-6-8-12(11)16(20)22-14(18)10(3)4/h11-12H,1,3,5-8H2,2,4H3.
What are the key properties of bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate?
bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate has a molecular weight of 308.33 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylprop-2-enoyl) cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 87249059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).