C15H17F2NO4 — CID 87249176
[(2S)-2-[(1R,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3,3-difluoro-4-phenylbutyl]carbamic acid (PubChem CID 87249176) has the molecular formula C15H17F2NO4 and a molecular weight of 313.30 g/mol. Its IUPAC name is [(2S)-2-[(1R,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3,3-difluoro-4-phenylbutyl]carbamic acid.
| Compound Name | [(2S)-2-[(1R,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3,3-difluoro-4-phenylbutyl]carbamic acid |
|---|---|
| PubChem CID | 87249176 |
| Molecular Formula | C15H17F2NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [(2S)-2-[(1R,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3,3-difluoro-4-phenylbutyl]carbamic acid |
| SMILES | O=C(O)NC[C@@H]([C@H]1OC[C@@H]2O[C@H]12)C(F)(F)Cc1ccccc1 |
| InChI | InChI=1S/C15H17F2NO4/c16-15(17,6-9-4-2-1-3-5-9)10(7-18-14(19)20)12-13-11(22-13)8-21-12/h1-5,10-13,18H,6-8H2,(H,19,20)/t10-,11-,12+,13-/m0/s1 |
| InChIKey | GPQQSWNPXKANJT-RVMXOQNASA-N |
| XLogP | 1.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|