C23H17F9O6S3 — CID 87249724
1,1,2,2,3,3-hexafluoro-4-(trifluoromethylsulfonyloxy)butane-1-sulfonate;triphenylsulfanium (PubChem CID 87249724) has the molecular formula C23H17F9O6S3 and a molecular weight of 656.57 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-4-(trifluoromethylsulfonyloxy)butane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,2,3,3-hexafluoro-4-(trifluoromethylsulfonyloxy)butane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87249724 |
| Molecular Formula | C23H17F9O6S3 |
| Molecular Weight | 656.57 g/mol |
| Exact Mass | 656.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-4-(trifluoromethylsulfonyloxy)butane-1-sulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)COS(=O)(=O)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C5H3F9O6S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-2(7,1-20-22(18,19)5(12,13)14)3(8,9)4(10,11)21(15,16)17/h1-15H;1H2,(H,15,16,17)/q+1;/p-1 |
| InChIKey | RVRHUAYHPDATGA-UHFFFAOYSA-M |
| XLogP | 6.04 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|