About (E)-but-1-ene-1,2,3-triamine
(E)-but-1-ene-1,2,3-triamine (PubChem CID 87249857) has the molecular formula C4H11N3
and a molecular weight of 101.15 g/mol. Its IUPAC name is (E)-but-1-ene-1,2,3-triamine.
Molecular Properties
| Compound Name | (E)-but-1-ene-1,2,3-triamine |
| PubChem CID | 87249857 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | (E)-but-1-ene-1,2,3-triamine |
| SMILES | CC(N)/C(N)=C\N |
| InChI | InChI=1S/C4H11N3/c1-3(6)4(7)2-5/h2-3H,5-7H2,1H3/b4-2+ |
| InChIKey | NRPREXAZMRESLT-DUXPYHPUSA-N |
| XLogP | -0.91 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-but-1-ene-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-1-ene-1,2,3-triamine?
The IUPAC name of (E)-but-1-ene-1,2,3-triamine (CID 87249857) is (E)-but-1-ene-1,2,3-triamine.
What is the SMILES notation for (E)-but-1-ene-1,2,3-triamine?
The canonical SMILES for (E)-but-1-ene-1,2,3-triamine is CC(N)/C(N)=C\N.
What is the InChIKey of (E)-but-1-ene-1,2,3-triamine?
The InChIKey is NRPREXAZMRESLT-DUXPYHPUSA-N. The full InChI is InChI=1S/C4H11N3/c1-3(6)4(7)2-5/h2-3H,5-7H2,1H3/b4-2+.
What are the key properties of (E)-but-1-ene-1,2,3-triamine?
(E)-but-1-ene-1,2,3-triamine has a molecular weight of 101.15 g/mol, XLogP of -0.91, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-1-ene-1,2,3-triamine is sourced from PubChem (CID 87249857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).