About 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate
5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate (PubChem CID 87250006) has the molecular formula C13H18O6
and a molecular weight of 270.28 g/mol. Its IUPAC name is 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate.
Molecular Properties
| Compound Name | 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate |
| PubChem CID | 87250006 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate |
| SMILES | C=C(CC=CC(=O)O)C(=O)OCC.C=CC(=O)OC |
| InChI | InChI=1S/C9H12O4.C4H6O2/c1-3-13-9(12)7(2)5-4-6-8(10)11;1-3-4(5)6-2/h4,6H,2-3,5H2,1H3,(H,10,11);3H,1H2,2H3 |
| InChIKey | DAANUHKMANJOOT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate?
The IUPAC name of 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate (CID 87250006) is 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate.
What is the SMILES notation for 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate?
The canonical SMILES for 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate is C=C(CC=CC(=O)O)C(=O)OCC.C=CC(=O)OC.
What is the InChIKey of 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate?
The InChIKey is DAANUHKMANJOOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4.C4H6O2/c1-3-13-9(12)7(2)5-4-6-8(10)11;1-3-4(5)6-2/h4,6H,2-3,5H2,1H3,(H,10,11);3H,1H2,2H3.
What are the key properties of 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate?
5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate has a molecular weight of 270.28 g/mol, XLogP of 1.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxycarbonylhexa-2,5-dienoic acid;methyl prop-2-enoate is sourced from PubChem (CID 87250006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).