C39H38N2O13S — CID 87250350
(2R,3R)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid;(5R)-5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 87250350) has the molecular formula C39H38N2O13S and a molecular weight of 774.80 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid;(5R)-5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (2R,3R)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid;(5R)-5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87250350 |
| Molecular Formula | C39H38N2O13S |
| Molecular Weight | 774.80 g/mol |
| Exact Mass | 774.21 |
| IUPAC Name | (2R,3R)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid;(5R)-5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1ccc(CCOc2ccc(C[C@H]3SC(=O)NC3=O)cc2)nc1.COc1ccc(C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)c2ccc(OC)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H18O10.C19H20N2O3S/c1-27-13-7-3-11(4-8-13)19(25)29-15(17(21)22)16(18(23)24)30-20(26)12-5-9-14(28-2)10-6-12;1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);3-8,12,17H,2,9-11H2,1H3,(H,21,22,23)/t15-,16-;17-/m11/s1 |
| InChIKey | FPRQQZXVSDTIBX-OFTBZXHVSA-N |
| XLogP | 4.78 |
| TPSA | 213.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.80 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|