C23H37N7O2 — CID 87250505
1-[4-[4-amino-6,7-dimethyl-2-[(propan-2-ylideneamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]-1-cyclohexylurea (PubChem CID 87250505) has the molecular formula C23H37N7O2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 1-[4-[4-amino-6,7-dimethyl-2-[(propan-2-ylideneamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]-1-cyclohexylurea.
| Compound Name | 1-[4-[4-amino-6,7-dimethyl-2-[(propan-2-ylideneamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]-1-cyclohexylurea |
|---|---|
| PubChem CID | 87250505 |
| Molecular Formula | C23H37N7O2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | 1-[4-[4-amino-6,7-dimethyl-2-[(propan-2-ylideneamino)oxymethyl]imidazo[4,5-c]pyridin-1-yl]butyl]-1-cyclohexylurea |
| SMILES | CC(C)=NOCc1nc2c(N)nc(C)c(C)c2n1CCCCN(C(N)=O)C1CCCCC1 |
| InChI | InChI=1S/C23H37N7O2/c1-15(2)28-32-14-19-27-20-21(16(3)17(4)26-22(20)24)30(19)13-9-8-12-29(23(25)31)18-10-6-5-7-11-18/h18H,5-14H2,1-4H3,(H2,24,26)(H2,25,31) |
| InChIKey | BRYJAQXWYNYVPC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|