C20H14Br3NO5S — CID 87250530
2-(4-methoxyphenyl)-4-[(2,3,5-tribromo-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 87250530) has the molecular formula C20H14Br3NO5S and a molecular weight of 620.11 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-[(2,3,5-tribromo-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 2-(4-methoxyphenyl)-4-[(2,3,5-tribromo-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 87250530 |
| Molecular Formula | C20H14Br3NO5S |
| Molecular Weight | 620.11 g/mol |
| Exact Mass | 616.81 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-[(2,3,5-tribromo-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | COc1ccc(-c2scc(NC(=O)c3cc(Br)c(OC)c(Br)c3Br)c2C(=O)O)cc1 |
| InChI | InChI=1S/C20H14Br3NO5S/c1-28-10-5-3-9(4-6-10)18-14(20(26)27)13(8-30-18)24-19(25)11-7-12(21)17(29-2)16(23)15(11)22/h3-8H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | YMWFYHCMVAQLSO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.11 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|