About acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine
acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine (PubChem CID 87251079) has the molecular formula C39H31N5O3S2
and a molecular weight of 681.84 g/mol. Its IUPAC name is acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine.
Molecular Properties
| Compound Name | acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine |
| PubChem CID | 87251079 |
| Molecular Formula | C39H31N5O3S2 |
| Molecular Weight | 681.84 g/mol |
| Exact Mass | 681.19 |
| IUPAC Name | acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine |
| SMILES | NCCNc1cccc2c(S(=O)(=O)O)cccc12.S=C=Nc1cccc2nc3ccccc3cc12.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H8N2S.C13H9N.C12H14N2O3S/c17-9-15-13-6-3-7-14-11(13)8-10-4-1-2-5-12(10)16-14;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;13-7-8-14-11-5-1-4-10-9(11)3-2-6-12(10)18(15,16)17/h1-8H;1-9H;1-6,14H,7-8,13H2,(H,15,16,17) |
| InChIKey | MMISFGRUWSZSQZ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 681.84 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine?
The IUPAC name of acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine (CID 87251079) is acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine.
What is the SMILES notation for acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine?
The canonical SMILES for acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine is NCCNc1cccc2c(S(=O)(=O)O)cccc12.S=C=Nc1cccc2nc3ccccc3cc12.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine?
The InChIKey is MMISFGRUWSZSQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2S.C13H9N.C12H14N2O3S/c17-9-15-13-6-3-7-14-11(13)8-10-4-1-2-5-12(10)16-14;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;13-7-8-14-11-5-1-4-10-9(11)3-2-6-12(10)18(15,16)17/h1-8H;1-9H;1-6,14H,7-8,13H2,(H,15,16,17).
What are the key properties of acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine?
acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine has a molecular weight of 681.84 g/mol, XLogP of 8.97, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;5-(2-aminoethylamino)naphthalene-1-sulfonic acid;1-isothiocyanatoacridine is sourced from PubChem (CID 87251079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).