About 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione
8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione (PubChem CID 87251417) has the molecular formula C14H14ClN5O2
and a molecular weight of 319.75 g/mol. Its IUPAC name is 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione |
| PubChem CID | 87251417 |
| Molecular Formula | C14H14ClN5O2 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione |
| SMILES | CCn1c(=O)c2[nH]c(-c3ccc(Cl)nc3)nc2n(CC)c1=O |
| InChI | InChI=1S/C14H14ClN5O2/c1-3-19-12-10(13(21)20(4-2)14(19)22)17-11(18-12)8-5-6-9(15)16-7-8/h5-7H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | VXUBRKBECGMJLK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione?
The IUPAC name of 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione (CID 87251417) is 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione?
The canonical SMILES for 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione is CCn1c(=O)c2[nH]c(-c3ccc(Cl)nc3)nc2n(CC)c1=O.
What is the InChIKey of 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione?
The InChIKey is VXUBRKBECGMJLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN5O2/c1-3-19-12-10(13(21)20(4-2)14(19)22)17-11(18-12)8-5-6-9(15)16-7-8/h5-7H,3-4H2,1-2H3,(H,17,18).
What are the key properties of 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione?
8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione has a molecular weight of 319.75 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(6-chloro-3-pyridinyl)-1,3-diethyl-7H-purine-2,6-dione is sourced from PubChem (CID 87251417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).