About 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane
2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane (PubChem CID 87251597) has the molecular formula C15H10Cl2F2O
and a molecular weight of 315.15 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane.
Molecular Properties
| Compound Name | 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane |
| PubChem CID | 87251597 |
| Molecular Formula | C15H10Cl2F2O |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane |
| SMILES | Fc1cc(F)cc(C2(CCl)OC2c2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H10Cl2F2O/c16-8-15(9-5-10(18)7-11(19)6-9)14(20-15)12-3-1-2-4-13(12)17/h1-7,14H,8H2 |
| InChIKey | RKIBAWPARJWZKC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane?
The IUPAC name of 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane (CID 87251597) is 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane.
What is the SMILES notation for 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane?
The canonical SMILES for 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane is Fc1cc(F)cc(C2(CCl)OC2c2ccccc2Cl)c1.
What is the InChIKey of 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane?
The InChIKey is RKIBAWPARJWZKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2F2O/c16-8-15(9-5-10(18)7-11(19)6-9)14(20-15)12-3-1-2-4-13(12)17/h1-7,14H,8H2.
What are the key properties of 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane?
2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane has a molecular weight of 315.15 g/mol, XLogP of 4.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-3-(2-chlorophenyl)-2-(3,5-difluorophenyl)oxirane is sourced from PubChem (CID 87251597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).