About hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol
hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol (PubChem CID 87252011) has the molecular formula C33H37O3Ti
and a molecular weight of 529.52 g/mol. Its IUPAC name is hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol.
Molecular Properties
| Compound Name | hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol |
| PubChem CID | 87252011 |
| Molecular Formula | C33H37O3Ti |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol |
| SMILES | CC(C)(c1ccccc1)c1ccc(O)c(C(C)(C)c2ccccc2)c1C(C)(C)c1ccccc1.O=[Ti]O |
| InChI | InChI=1S/C33H36O.H2O.O.Ti/c1-31(2,24-16-10-7-11-17-24)27-22-23-28(34)30(33(5,6)26-20-14-9-15-21-26)29(27)32(3,4)25-18-12-8-13-19-25;;;/h7-23,34H,1-6H3;1H2;;/q;;;+1/p-1 |
| InChIKey | GRGYMRDCSSSLOT-UHFFFAOYSA-M |
| XLogP | 7.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol?
The IUPAC name of hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol (CID 87252011) is hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol.
What is the SMILES notation for hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol?
The canonical SMILES for hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol is CC(C)(c1ccccc1)c1ccc(O)c(C(C)(C)c2ccccc2)c1C(C)(C)c1ccccc1.O=[Ti]O.
What is the InChIKey of hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol?
The InChIKey is GRGYMRDCSSSLOT-UHFFFAOYSA-M. The full InChI is InChI=1S/C33H36O.H2O.O.Ti/c1-31(2,24-16-10-7-11-17-24)27-22-23-28(34)30(33(5,6)26-20-14-9-15-21-26)29(27)32(3,4)25-18-12-8-13-19-25;;;/h7-23,34H,1-6H3;1H2;;/q;;;+1/p-1.
What are the key properties of hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol?
hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol has a molecular weight of 529.52 g/mol, XLogP of 7.69, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy(oxo)titanium;2,3,4-tris(2-phenylpropan-2-yl)phenol is sourced from PubChem (CID 87252011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).