C31H49NO8 — CID 87252253
[(4E)-8,10-dihydroxy-2-[(2E,4E)-7-[3-(3-methoxyiminopentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 87252253) has the molecular formula C31H49NO8 and a molecular weight of 563.73 g/mol. Its IUPAC name is [(4E)-8,10-dihydroxy-2-[(2E,4E)-7-[3-(3-methoxyiminopentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-8,10-dihydroxy-2-[(2E,4E)-7-[3-(3-methoxyiminopentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 87252253 |
| Molecular Formula | C31H49NO8 |
| Molecular Weight | 563.73 g/mol |
| Exact Mass | 563.35 |
| IUPAC Name | [(4E)-8,10-dihydroxy-2-[(2E,4E)-7-[3-(3-methoxyiminopentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(=NOC)C(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CC(O)CC(O)C(C)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C31H49NO8/c1-9-25(32-37-8)21(5)31-28(39-31)15-18(2)11-10-12-19(3)30-20(4)13-14-27(38-23(7)33)22(6)26(35)16-24(34)17-29(36)40-30/h10-14,18,20-22,24,26-28,30-31,34-35H,9,15-17H2,1-8H3/b11-10+,14-13+,19-12+,32-25? |
| InChIKey | DJROMISWRRATPJ-KJTJYRMMSA-N |
| XLogP | 4.52 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.73 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|