C14H25FO4Si — CID 87252342
2-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxabicyclo[3.1.0]hexan-2-yl]-2-fluoropropanoic acid (PubChem CID 87252342) has the molecular formula C14H25FO4Si and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxabicyclo[3.1.0]hexan-2-yl]-2-fluoropropanoic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxabicyclo[3.1.0]hexan-2-yl]-2-fluoropropanoic acid |
|---|---|
| PubChem CID | 87252342 |
| Molecular Formula | C14H25FO4Si |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-6-oxabicyclo[3.1.0]hexan-2-yl]-2-fluoropropanoic acid |
| SMILES | CC(F)(C(=O)O)[C@@H]1[C@H]2O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H25FO4Si/c1-13(2,3)20(5,6)19-8-7-9-11(18-9)10(8)14(4,15)12(16)17/h8-11H,7H2,1-6H3,(H,16,17)/t8-,9+,10+,11+,14?/m1/s1 |
| InChIKey | XFJJVTGMLMPQSE-ATVZIQIISA-N |
| XLogP | 2.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|