C24H46O17 — CID 87252601
2-[2-[2-[2-(2-ethyl-2,3,4,5,6-pentahydroxyhexanoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-ethyl-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 87252601) has the molecular formula C24H46O17 and a molecular weight of 606.61 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-ethyl-2,3,4,5,6-pentahydroxyhexanoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-ethyl-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | 2-[2-[2-[2-(2-ethyl-2,3,4,5,6-pentahydroxyhexanoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-ethyl-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 87252601 |
| Molecular Formula | C24H46O17 |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 2-[2-[2-[2-(2-ethyl-2,3,4,5,6-pentahydroxyhexanoyl)oxyethoxy]ethoxy]ethoxy]ethyl 2-ethyl-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | CCC(O)(C(=O)OCCOCCOCCOCCOC(=O)C(O)(CC)C(O)C(O)C(O)CO)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C24H46O17/c1-3-23(35,19(31)17(29)15(27)13-25)21(33)40-11-9-38-7-5-37-6-8-39-10-12-41-22(34)24(36,4-2)20(32)18(30)16(28)14-26/h15-20,25-32,35-36H,3-14H2,1-2H3 |
| InChIKey | FLSSOYNJLHGULF-UHFFFAOYSA-N |
| XLogP | -5.45 |
| TPSA | 282.59 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | -5.45 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|