C21H23F3N2O5S — CID 87253178
2-[[5-[3-[methyl(oxiran-2-ylmethyl)sulfamoyl]-5-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]butanoic acid (PubChem CID 87253178) has the molecular formula C21H23F3N2O5S and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-[[5-[3-[methyl(oxiran-2-ylmethyl)sulfamoyl]-5-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]butanoic acid.
| Compound Name | 2-[[5-[3-[methyl(oxiran-2-ylmethyl)sulfamoyl]-5-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 87253178 |
| Molecular Formula | C21H23F3N2O5S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-[[5-[3-[methyl(oxiran-2-ylmethyl)sulfamoyl]-5-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]butanoic acid |
| SMILES | CCC(Cc1ccc(-c2cc(C(F)(F)F)cc(S(=O)(=O)N(C)CC3CO3)c2)cn1)C(=O)O |
| InChI | InChI=1S/C21H23F3N2O5S/c1-3-13(20(27)28)7-17-5-4-14(10-25-17)15-6-16(21(22,23)24)9-19(8-15)32(29,30)26(2)11-18-12-31-18/h4-6,8-10,13,18H,3,7,11-12H2,1-2H3,(H,27,28) |
| InChIKey | CLVUNNQBHZFNOU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|