C22H18F4N2O4 — CID 87253587
(2S)-5-(2-fluoroethoxymethyl)-2-[[4-(2,3,5-trifluorophenyl)phenoxy]methyl]-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-7-one (PubChem CID 87253587) has the molecular formula C22H18F4N2O4 and a molecular weight of 450.39 g/mol. Its IUPAC name is (2S)-5-(2-fluoroethoxymethyl)-2-[[4-(2,3,5-trifluorophenyl)phenoxy]methyl]-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (2S)-5-(2-fluoroethoxymethyl)-2-[[4-(2,3,5-trifluorophenyl)phenoxy]methyl]-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 87253587 |
| Molecular Formula | C22H18F4N2O4 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (2S)-5-(2-fluoroethoxymethyl)-2-[[4-(2,3,5-trifluorophenyl)phenoxy]methyl]-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-7-one |
| SMILES | O=c1cc(COCCF)n2c(n1)O[C@H](COc1ccc(-c3cc(F)cc(F)c3F)cc1)C2 |
| InChI | InChI=1S/C22H18F4N2O4/c23-5-6-30-11-15-9-20(29)27-22-28(15)10-17(32-22)12-31-16-3-1-13(2-4-16)18-7-14(24)8-19(25)21(18)26/h1-4,7-9,17H,5-6,10-12H2/t17-/m0/s1 |
| InChIKey | KZYZERZOYPQCJK-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|