C17H19FN2O6S — CID 87253596
[(2S)-5-(2-fluoroethoxymethyl)-7-oxo-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87253596) has the molecular formula C17H19FN2O6S and a molecular weight of 398.41 g/mol. Its IUPAC name is [(2S)-5-(2-fluoroethoxymethyl)-7-oxo-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S)-5-(2-fluoroethoxymethyl)-7-oxo-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87253596 |
| Molecular Formula | C17H19FN2O6S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [(2S)-5-(2-fluoroethoxymethyl)-7-oxo-2,3-dihydro-[1,3]oxazolo[3,2-a]pyrimidin-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2Cn3c(COCCF)cc(=O)nc3O2)cc1 |
| InChI | InChI=1S/C17H19FN2O6S/c1-12-2-4-15(5-3-12)27(22,23)25-11-14-9-20-13(10-24-7-6-18)8-16(21)19-17(20)26-14/h2-5,8,14H,6-7,9-11H2,1H3/t14-/m0/s1 |
| InChIKey | SSGAHFKCJGHVCB-AWEZNQCLSA-N |
| XLogP | 1.20 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|