About Silyl propyl methacrylate
Silyl propyl methacrylate (PubChem CID 87253710) has the molecular formula C7H11O2Si
and a molecular weight of 155.25 g/mol.
Molecular Properties
| Compound Name | Silyl propyl methacrylate |
| PubChem CID | 87253710 |
| Molecular Formula | C7H11O2Si |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | — |
| SMILES | CCCOC(=O)/C(C)=C/[Si] |
| InChI | InChI=1S/C7H11O2Si/c1-3-4-9-7(8)6(2)5-10/h5H,3-4H2,1-2H3/b6-5+ |
| InChIKey | ONJCBGVRNVRJNJ-AATRIKPKSA-N |
| XLogP | 1.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze Silyl propyl methacrylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silyl propyl methacrylate?
The IUPAC name of Silyl propyl methacrylate (CID 87253710) is not available.
What is the SMILES notation for Silyl propyl methacrylate?
The canonical SMILES for Silyl propyl methacrylate is CCCOC(=O)/C(C)=C/[Si].
What is the InChIKey of Silyl propyl methacrylate?
The InChIKey is ONJCBGVRNVRJNJ-AATRIKPKSA-N. The full InChI is InChI=1S/C7H11O2Si/c1-3-4-9-7(8)6(2)5-10/h5H,3-4H2,1-2H3/b6-5+.
What are the key properties of Silyl propyl methacrylate?
Silyl propyl methacrylate has a molecular weight of 155.25 g/mol, XLogP of 1.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Silyl propyl methacrylate is sourced from PubChem (CID 87253710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).