C17H24O2 — CID 87253823
(7Z,10Z,13Z)-17-oxabicyclo[14.2.0]octadeca-7,10,13-trien-18-one (PubChem CID 87253823) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (7Z,10Z,13Z)-17-oxabicyclo[14.2.0]octadeca-7,10,13-trien-18-one.
| Compound Name | (7Z,10Z,13Z)-17-oxabicyclo[14.2.0]octadeca-7,10,13-trien-18-one |
|---|---|
| PubChem CID | 87253823 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (7Z,10Z,13Z)-17-oxabicyclo[14.2.0]octadeca-7,10,13-trien-18-one |
| SMILES | O=C1OC2C/C=C\C/C=C\C/C=C\CCCCCC12 |
| InChI | InChI=1S/C17H24O2/c18-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(15)19-17/h1,3-4,6,10,12,15-16H,2,5,7-9,11,13-14H2/b3-1-,6-4-,12-10- |
| InChIKey | ZEIMQGRQPWIUTP-DYRGNDFMSA-N |
| XLogP | 4.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|