C19H9BrO4 — CID 87254169
6-benzoyl-8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 87254169) has the molecular formula C19H9BrO4 and a molecular weight of 381.18 g/mol. Its IUPAC name is 6-benzoyl-8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 6-benzoyl-8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 87254169 |
| Molecular Formula | C19H9BrO4 |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 6-benzoyl-8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | O=C(c1ccccc1)c1cc(Br)c2cccc3c2c1C(=O)OC3=O |
| InChI | InChI=1S/C19H9BrO4/c20-14-9-13(17(21)10-5-2-1-3-6-10)16-15-11(14)7-4-8-12(15)18(22)24-19(16)23/h1-9H |
| InChIKey | QVFXSOLRCGHEFT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|