C31H28ClCuN3 — CID 87254270
copper;(2S,3S)-2,3-diphenyl-6-(2,4,6-trimethylphenyl)-3,5-dihydro-2H-imidazo[1,2-c]quinazolin-5-ide;chloride (PubChem CID 87254270) has the molecular formula C31H28ClCuN3 and a molecular weight of 541.59 g/mol. Its IUPAC name is copper;(2S,3S)-2,3-diphenyl-6-(2,4,6-trimethylphenyl)-3,5-dihydro-2H-imidazo[1,2-c]quinazolin-5-ide;chloride.
| Compound Name | copper;(2S,3S)-2,3-diphenyl-6-(2,4,6-trimethylphenyl)-3,5-dihydro-2H-imidazo[1,2-c]quinazolin-5-ide;chloride |
|---|---|
| PubChem CID | 87254270 |
| Molecular Formula | C31H28ClCuN3 |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | copper;(2S,3S)-2,3-diphenyl-6-(2,4,6-trimethylphenyl)-3,5-dihydro-2H-imidazo[1,2-c]quinazolin-5-ide;chloride |
| SMILES | Cc1cc(C)c(N2[CH-]N3C(=N[C@@H](c4ccccc4)[C@@H]3c3ccccc3)c3ccccc32)c(C)c1.[Cl-].[Cu+2] |
| InChI | InChI=1S/C31H28N3.ClH.Cu/c1-21-18-22(2)29(23(3)19-21)33-20-34-30(25-14-8-5-9-15-25)28(24-12-6-4-7-13-24)32-31(34)26-16-10-11-17-27(26)33;;/h4-20,28,30H,1-3H3;1H;/q-1;;+2/p-1/t28-,30-;;/m0../s1 |
| InChIKey | CLAUWNIJIYFBKL-HNQRYHMESA-M |
| XLogP | 4.43 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|