C16H26N2O16P2 — CID 87254430
[(2R,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphono [(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate (PubChem CID 87254430) has the molecular formula C16H26N2O16P2 and a molecular weight of 564.33 g/mol. Its IUPAC name is [(2R,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphono [(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate.
| Compound Name | [(2R,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphono [(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
|---|---|
| PubChem CID | 87254430 |
| Molecular Formula | C16H26N2O16P2 |
| Molecular Weight | 564.33 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | [(2R,5R)-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphono [(2S,3R,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate |
| SMILES | Cc1cn([C@H]2CC(O)[C@@H](COP(=O)(O[C@@H]3O[C@H](CO)[C@H](O)[C@@H](O)[C@H]3O)OP(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H26N2O16P2/c1-6-3-18(16(25)17-14(6)24)10-2-7(20)9(31-10)5-30-36(29,34-35(26,27)28)33-15-13(23)12(22)11(21)8(4-19)32-15/h3,7-13,15,19-23H,2,4-5H2,1H3,(H,17,24,25)(H2,26,27,28)/t7?,8-,9-,10-,11+,12-,13-,15+,36?/m1/s1 |
| InChIKey | PVTNXMSFPHDFAQ-BHKKCLMXSA-N |
| XLogP | -3.46 |
| TPSA | 276.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.33 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|