C17H31BrOSi2 — CID 87254471
[(4R,5E,7E)-8-bromo-4-[tert-butyl(dimethyl)silyl]oxyocta-5,7-dien-1-ynyl]-trimethylsilane (PubChem CID 87254471) has the molecular formula C17H31BrOSi2 and a molecular weight of 387.51 g/mol. Its IUPAC name is [(4R,5E,7E)-8-bromo-4-[tert-butyl(dimethyl)silyl]oxyocta-5,7-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(4R,5E,7E)-8-bromo-4-[tert-butyl(dimethyl)silyl]oxyocta-5,7-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 87254471 |
| Molecular Formula | C17H31BrOSi2 |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [(4R,5E,7E)-8-bromo-4-[tert-butyl(dimethyl)silyl]oxyocta-5,7-dien-1-ynyl]-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/C=C/Br)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C17H31BrOSi2/c1-17(2,3)21(7,8)19-16(12-9-10-14-18)13-11-15-20(4,5)6/h9-10,12,14,16H,13H2,1-8H3/b12-9+,14-10+/t16-/m0/s1 |
| InChIKey | VIHUZWIWUDOHCO-VBDKHZPGSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|