C10H14N3O2+ — CID 87255899
(3-methylimidazol-3-ium-1-yl)-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone (PubChem CID 87255899) has the molecular formula C10H14N3O2+ and a molecular weight of 208.24 g/mol. Its IUPAC name is (3-methylimidazol-3-ium-1-yl)-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone.
| Compound Name | (3-methylimidazol-3-ium-1-yl)-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone |
|---|---|
| PubChem CID | 87255899 |
| Molecular Formula | C10H14N3O2+ |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3-methylimidazol-3-ium-1-yl)-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]methanone |
| SMILES | C[n+]1ccn(C(=O)N2C[C@@H]3C[C@H]2CO3)c1 |
| InChI | InChI=1S/C10H14N3O2/c1-11-2-3-12(7-11)10(14)13-5-9-4-8(13)6-15-9/h2-3,7-9H,4-6H2,1H3/q+1/t8-,9-/m0/s1 |
| InChIKey | PVYBFXNJYYHEHJ-IUCAKERBSA-N |
| XLogP | -0.25 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|