About scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole
scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole (PubChem CID 87255972) has the molecular formula C4HF6N3O2SSc
and a molecular weight of 314.08 g/mol. Its IUPAC name is scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole |
| PubChem CID | 87255972 |
| Molecular Formula | C4HF6N3O2SSc |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole |
| SMILES | O=S(=O)(c1n[nH]c(C(F)(F)F)n1)C(F)(F)F.[Sc] |
| InChI | InChI=1S/C4HF6N3O2S.Sc/c5-3(6,7)1-11-2(13-12-1)16(14,15)4(8,9)10;/h(H,11,12,13); |
| InChIKey | OMFYBZBMZZVJMD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole?
The IUPAC name of scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole (CID 87255972) is scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole.
What is the SMILES notation for scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole?
The canonical SMILES for scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole is O=S(=O)(c1n[nH]c(C(F)(F)F)n1)C(F)(F)F.[Sc].
What is the InChIKey of scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole?
The InChIKey is OMFYBZBMZZVJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HF6N3O2S.Sc/c5-3(6,7)1-11-2(13-12-1)16(14,15)4(8,9)10;/h(H,11,12,13);.
What are the key properties of scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole?
scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole has a molecular weight of 314.08 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for scandium;5-(trifluoromethyl)-3-(trifluoromethylsulfonyl)-1H-1,2,4-triazole is sourced from PubChem (CID 87255972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).